-Bromoindoxyl acetate
5-Bromoindoxyl diacetate
CAS: 33588-54-4
Molecular Formula: C12H10BrNO3
-Bromoindoxyl acetate - Names and Identifiers
| Name | 5-Bromoindoxyl diacetate |
| Synonyms | -Bromoindoxyl acetate 5-BROMOINDOXYL DIACETATE 5-Bromoindoxyl diacetate 5-BROMOINDOXYL-1,3-DIACETATE 5-Bromoindolyl-1,3-diacetate N-acetyl-5-bromoindolyl acetate 3-Acetoxy-1-acetyl-5-bromoindole 1-Acetyl-5-bromoindol-3-ol acetate 1-Acetyl-5-bromo-1H-indol-3-ol acetate 1-Acetyl-5-bromo-1H-indol-3-yl acetate 1-acetyl-5-bromo-1H-indol-3-yl acetate 1-acetyl-5-bromo-1h-indol-3-oacetate(ester) ACETIC ACID 1-ACETYL-5-BROMO-1H-INDOL-3-YL ESTER |
| CAS | 33588-54-4 |
| EINECS | 251-584-0 |
| InChI | InChI=1/C12H10BrNO3/c1-7(15)14-6-12(17-8(2)16)10-5-9(13)3-4-11(10)14/h3-6H,1-2H3 |
-Bromoindoxyl acetate - Physico-chemical Properties
| Molecular Formula | C12H10BrNO3 |
| Molar Mass | 296.12 |
| Density | 1.6469 (rough estimate) |
| Melting Point | 125-128°C(lit.) |
| Boling Point | 395.7±22.0 °C(Predicted) |
| Flash Point | 193.1°C |
| Vapor Presure | 1.81E-06mmHg at 25°C |
| BRN | 236935 |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.6200 (estimate) |
| MDL | MFCD00005799 |
-Bromoindoxyl acetate - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29339900 |
-Bromoindoxyl acetate - Introduction
5-Bromoindoxyl diacetate(5-Bromoindoxyl diacetate) is a chemical substance that has the following properties:
1. Appearance: white to light yellow solid;
2. Molecular formula: C14H11BrNO4;
3. Molecular weight: 346.14g/mol;
4. Melting Point: 110-112 ℃;
5. Solubility: Can be dissolved in organic solvents.
The compound is mainly used as a substrate in biological and biochemical experiments and certain medical tests.
Its preparation method is as follows:
Indoxyl is reacted with acetic anhydride and cuprous bromide in acetic acid. First, indoxyl and cuprous bromide are added to acetic acid and heated to react to produce 5-bromoindoxyl. Then, acetic anhydride is added and the reaction is continued to heat, resulting in the formation of 5-Bromoindoxyl diacetate.
About safety information:
1. 5-Bromoindoxyl diacetate is irritating, so you should pay attention to protective measures when using it, such as wearing protective gloves and safety glasses;
2. Contact with the skin may cause allergic reactions, avoid exposure to the skin;
3. If inhaled or ingested, seek medical attention immediately;
4. Storage should avoid direct sunlight and high temperature.
Please note that the use and handling of chemicals is recommended in a laboratory or under the guidance of a professional.
1. Appearance: white to light yellow solid;
2. Molecular formula: C14H11BrNO4;
3. Molecular weight: 346.14g/mol;
4. Melting Point: 110-112 ℃;
5. Solubility: Can be dissolved in organic solvents.
The compound is mainly used as a substrate in biological and biochemical experiments and certain medical tests.
Its preparation method is as follows:
Indoxyl is reacted with acetic anhydride and cuprous bromide in acetic acid. First, indoxyl and cuprous bromide are added to acetic acid and heated to react to produce 5-bromoindoxyl. Then, acetic anhydride is added and the reaction is continued to heat, resulting in the formation of 5-Bromoindoxyl diacetate.
About safety information:
1. 5-Bromoindoxyl diacetate is irritating, so you should pay attention to protective measures when using it, such as wearing protective gloves and safety glasses;
2. Contact with the skin may cause allergic reactions, avoid exposure to the skin;
3. If inhaled or ingested, seek medical attention immediately;
4. Storage should avoid direct sunlight and high temperature.
Please note that the use and handling of chemicals is recommended in a laboratory or under the guidance of a professional.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 5-Bromoindoxyl diacetate Visit Supplier Webpage Request for quotation
CAS: 33588-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33588-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-Bromoindoxyl diacetate Visit Supplier Webpage Request for quotation
CAS: 33588-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33588-54-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History